Tedizolid [CAS 856866-72-3]
Partner: MedChemexpress LLC
| CAS No: | 856866-72-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 370.34 |
| Formula: | C17H15FN6O3 |
| SMILES: | O=C1O[C@@H](CO)CN1C2=CC=C(C3=CC=C(C4=NN(C)N=N4)N=C3)C(F)=C2 |
| Purity: | 99.19 |
| Description: | Tedizolid (TR 700; Torezolid; DA-7157) is a novel oxazolidinone, acting through inhibition of bacterial protein synthesis by binding to 23S ribosomal RNA (rRNA) of the 50S subunit of the ribosome. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
