MC-VA-PABC-MMAE [CAS 1818864-51-5]
Partner: MedChemexpress LLC
| CAS No: | 1818864-51-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 1230.53 |
| Formula: | C65H99N9O14 |
| SMILES: | C[C@@H](C(N[C@H](C)[C@H](C1=CC=CC=C1)O)=O)[C@H]([C@@](CCC2)([H])N2C(C[C@@H](OC)[C@H]([C@@H](C)CC)N(C)C([C@H](C(C)C)NC([C@H](C(C)C)N(C)C(OCC(C=C3)=CC=C3NC([C@H](C)NC([C@H](C(C)C)NC(CCCCCN(C4=O)C(C=C4)=O)=O)=O)=O)=O)=O)=O)=O)OC |
| Purity: | 99.88 |
| Description: | MC-VA-PABC-MMAE is a agent-linker conjugate for ADC. MC-VA-PABC-MMAE contains the ADCs linker (peptide MC-VA-PABC) and a potent tubulin polymerization inhibitor MMAE (HY-15162)[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
