(Rac)-PF-998425 [CAS 1076225-26-7]
Partner: MedChemexpress LLC
| CAS No: | 1076225-26-7 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 269.26 |
| Formula: | C14H14F3NO |
| SMILES: | OC1C(CCCC1)C2=CC(C(F)(F)F)=C(C=C2)C#N |
| Purity: | 99.68 |
| Description: | (Rac)-PF-998425 is a potent, selective, nonsteroidal androgen receptor (AR) antagonist. (Rac)-PF-998425 has IC50 values of 26 and 90 nM in the AR binding and cellular assays, respectively. (Rac)-PF-998425 has the potential for the research of the androgenetic alopecia[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
