LSN3318839 [CAS 2764704-18-7]
Partner: MedChemexpress LLC
| CAS No: | 2764704-18-7 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 480.39 |
| Formula: | C26H23Cl2N3O2 |
| SMILES: | C[C@H](C1=CC=CC=C1C2=NC=C3N=CN(C3=C2)[C@@H](C4=C(C(C5CC5)=CC=C4Cl)Cl)C)C(O)=O |
| Purity: | 99.81 |
| Description: | LSN3318839 is an orally efficacious positive allosteric modulator of the glucagon-like peptide-1 receptor (GLP-1R). |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
