PC-Biotin-PEG4-NHS carbonate [CAS 2055198-03-1]
Partner: MedChemexpress LLC
| CAS No: | 2055198-03-1 |
| Applications: | Cancer-programmed cell death |
| MW: | 810.87 |
| Formula: | C35H50N6O14S |
| SMILES: | O=C1N[C@]2(CS[C@H]([C@]2(N1)[H])CCCCC(NCCOCCOCCOCCOCCC(NCC3=CC(C(OC(ON4C(CCC4=O)=O)=O)C)=C([N+]([O-])=O)C=C3)=O)=O)[H] |
| Purity: | 97.0 |
| Description: | PC-Biotin-PEG4-NHS carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
