7-TFA-ap-7-Deaza-dA [CAS 178420-75-2]
Partner: MedChemexpress LLC
CAS No: | 178420-75-2 |
Applications: | Cancer-programmed cell death |
MW: | 399.32 |
Formula: | C16H16F3N5O4 |
SMILES: | OC[C@@H]1[C@@H](O)C[C@H](N2C(N=CN=C3N)=C3C(C#CCNC(C(F)(F)F)=O)=C2)O1 |
Purity: | 98.81 |
Description: | 7-TFA-ap-7-Deaza-dA is a modified nucleoside. 7-TFA-ap-7-Deaza-dA can be used in the synthesis of deoxyribonucleic acid or nucleic acid. 7-TFA-ap-7-Deaza-dA is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice