7-TFA-ap-7-Deaza-dG [CAS 666847-77-4]
Partner: MedChemexpress LLC
CAS No: | 666847-77-4 |
Applications: | COVID-19-anti-virus |
MW: | 415.32 |
Formula: | C16H16F3N5O5 |
SMILES: | OC[C@@H]1[C@@H](O)C[C@H](N2C(N=C(N)NC3=O)=C3C(C#CCNC(C(F)(F)F)=O)=C2)O1 |
Purity: | 98.04 |
Description: | 5'-O-TBDMS-dG is a modified nucleoside. 5'-O-DMT-2'-O-TBDMS-rI can be used in the synthesis of deoxyribonucleic acid or nucleic acid. 7-TFA-ap-7-Deaza-dG is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice