Ezatiostat [CAS 168682-53-9]
Partner: MedChemexpress LLC
| CAS No: | 168682-53-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 529.65 |
| Formula: | C27H35N3O6S |
| SMILES: | O=C(OCC)[C@@H](C1=CC=CC=C1)NC([C@@H](NC(CC[C@H](N)C(OCC)=O)=O)CSCC2=CC=CC=C2)=O |
| Purity: | 99.19 |
| Description: | Ezatiostat (TER199 free base; TLK199) is a tripeptide analog of glutathione and is a selective and orally active glutathione S-transferase P1-1 (GSTP1) inhibitor. Ezatiostat leads to JNK activation by inhibiting GSTP1. Ezatiostat stimulates both lymphocyte production and bone marrow progenitor proliferation. Ezatiostat has the potential for myelodysplastic syndrome (MDS) treatment[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
