AQX-435 [CAS 1619983-52-6]
Partner: MedChemexpress LLC
| CAS No: | 1619983-52-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 450.57 |
| Formula: | C27H34N2O4 |
| SMILES: | O=C(C1=CC=CN=C1)N[C@@H]2C[C@@]3([H])C(C)(C)CCC[C@]3(C)[C@@H](C(C4=CC(O)=CC(O)=C4)=O)[C@@H]2C |
| Purity: | 99.19 |
| Description: | AQX-435 is a potent SHIP1 phosphatase activator. AQX-435 reduces PI3K activation downstream of the B-cell receptor (BCR) and induces apoptosis of malignant B cells, and reduces lymphoma growth[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
