Vimseltinib [CAS 1628606-05-2]
Partner: MedChemexpress LLC
| CAS No: | 1628606-05-2 |
| Applications: | Cancer-Kinase/protease |
| MW: | 431.49 |
| Formula: | C23H25N7O2 |
| SMILES: | O=C1N(C)C(NC(C)C)=NC=C1C2=NC(C)=C(OC3=CC(C4=CN(C)N=C4)=NC=C3)C=C2 |
| Purity: | 99.08 |
| Description: | Vimseltinib (DCC-3014) is a c-FMS (CSF-IR) and c-Kit dual inhibitor extracted from patent WO2014145025A2, Compound Example 10, has IC50s of <0.01 ?M and 0.1-1 ?M, respectively[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
