Monodes(N-carboxymethyl)valine Daclatasvir [CAS 1007884-60-7]
Partner: MedChemexpress LLC
| CAS No: | 1007884-60-7 |
| Applications: | COVID-19-anti-virus |
| MW: | 581.71 |
| Formula: | C33H39N7O3 |
| SMILES: | COC(N[C@@H](C(C)C)C(N(CCC1)[C@@H]1C2=NC(C3=CC=C(C4=CC=C(C5=CNC([C@H]6NCCC6)=N5)C=C4)C=C3)=CN2)=O)=O |
| Purity: | 92.26 |
| Description: | Monodes(N-carboxymethyl)valine Daclatasvir (Daclatasvir Impurity A) is the main degradation product of Daclatasvir. Daclatasvir is a potent HCV NS5A protein inhibitor[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
