N-Acetylcarnosine [CAS 56353-15-2]
Partner: MedChemexpress LLC
| CAS No: | 56353-15-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 268.27 |
| Formula: | C11H16N4O4 |
| SMILES: | OC([C@@H](NC(CCNC(C)=O)=O)CC1=CNC=N1)=O |
| Purity: | 99.85 |
| Description: | N-Acetylcarnosine, a natural histidine-containing dipeptide, is a source of pharmacological principal L-carnosine. N-Acetylcarnosine is a potent ophthalmic agent in human cataracts[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
