ZXH-4-130 (TFA) [CAS 2711006-67-4]
Partner: MedChemexpress LLC
| CAS No: | 2711006-67-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 985.08 |
| Formula: | C48H59F3N6O11S |
| SMILES: | O=C([C@H]1N(C([C@@H](NC(CCCCCCCCCCOC2=CC=CC(C(N3C(CC4)C(NC4=O)=O)=O)=C2C3=O)=O)C(C)(C)C)=O)C[C@H](O)C1)NCC5=CC=C(C6=C(C)N=CS6)C=C5.OC(C(F)(F)F)=O |
| Purity: | 99.53 |
| Description: | ZXH-4-130 TFA is a highly potent and selective degrader of CRBN. ZXH-4-130 is a CRBN-VHL compound (hetero-PROTAC). ZXH-4-130 TFA induces ~80% CRBN degradation at 10 nM in MM1.S cells[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
