Dazcapistat [CAS 2221010-42-8]
Partner: MedChemexpress LLC
| CAS No: | 2221010-42-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 395.38 |
| Formula: | C21H18FN3O4 |
| SMILES: | O=C(C(C(CC1=CC=CC=C1)NC(C2=C(C3=C(F)C=CC=C3)N=C(C)O2)=O)=O)N |
| Purity: | 98.0 |
| Description: | Dazcapistat is a potent calpain inhibitor, with IC50s of <3 ?M for calpain 1, calpain 2 and calpain 9, respectively (patent WO2018064119A1, compound 405)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
