Isoflupredone [CAS 338-95-4]
Partner: MedChemexpress LLC
| CAS No: | 338-95-4 |
| Applications: | COVID-19-immunoregulation |
| MW: | 378.43 |
| Formula: | C21H27FO5 |
| SMILES: | F[C@@]12[C@](CCC([C@@]2(C=C3)C)=CC3=O)([H])[C@@]4([H])[C@](C[C@@H]1O)([C@](O)(CC4)C(CO)=O)C |
| Purity: | 99.44 |
| Description: | Isoflupredone belongs to the class of corticosteroids and exerts its effect by binding to glucocorticoid and mineralocorticoid receptors of animals, such as horses. Isoflupredone can be used in wide range of conditions, such as infection and inflammatory diseases[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
