5-Aminouridine [CAS 2149-76-0]
Partner: MedChemexpress LLC
| CAS No: | 2149-76-0 |
| Applications: | COVID-19-anti-virus |
| MW: | 259.22 |
| Formula: | C9H13N3O6 |
| SMILES: | OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N(C(N2)=O)C=C(N)C2=O)O1 |
| Description: | 5-Aminouridine can modify nucleobases and can be incorporated into the target DNA. 5-Aminouridine exhibits a wide range of biological activity and it inhibits the growth of tumors, fungi and viruses[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
