5-Dehydroepisterol [CAS 23582-83-4]
Partner: MedChemexpress LLC
| CAS No: | 23582-83-4 |
| Applications: | COVID-19-immunoregulation |
| MW: | 396.65 |
| Formula: | C28H44O |
| SMILES: | C=C(C(C)C)CC[C@@H](C)[C@H]1CC[C@@]2([H])C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Purity: | 92.36 |
| Description: | 5-Dehydroepisterol is an episterol derivative and an�intermediate�in�steroid biosynthesis. 5-Dehydroepisterol can be formed by�C-5 sterol desaturase�and converted into�24-methylenecholesterol�by�7-dehydrocholesterol reductase. 5-Dehydroepisterol has anti-fungal activities[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
