SPR719 [CAS 1384984-18-2]
Partner: MedChemexpress LLC
| CAS No: | 1384984-18-2 |
| Applications: | COVID-19-anti-virus |
| MW: | 428.46 |
| Formula: | C21H25FN6O3 |
| SMILES: | O=C(NC1=NC2=CC(C3=CN=C(C(C)(O)C)N=C3)=C(F)C([C@@H]4OCCC4)=C2N1)NCC |
| Purity: | 99.50 |
| Description: | SPR719 (VXc-486) is a gyrase B inhibitor, with bactericidal activity. SPR719 potently inhibits multiple agent-sensitive isolates and drug-resistant isolates of Mycobacterium tuberculosis, with MICs of 0.03 to 0.30 ?g/ml and 0.08 to 5.48 ?g/ml, respectively[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
