KH-CB19 [CAS 1354037-26-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1354037-26-5 |
| Applications: | Cancer-Kinase/protease |
| MW: | 338.19 |
| Formula: | C15H13Cl2N3O2 |
| SMILES: | CCOC(C1=C(C2=C(C(Cl)=C(C=C2)Cl)N1C)/C(C#N)=C\N)=O |
| Purity: | 99.31 |
| Description: | KH-CB19 is a potent CLK (cdc2-like kinase) inhibitor (CLK1 IC50=19.7 nM; CLK3 IC50=530 nM). KH-CB19 shows antiviral activity and inhibits influenza virus replication (IC50=13.6??M)[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
