NNK [CAS 64091-91-4]
Partner: MedChemexpress LLC
| CAS No: | 64091-91-4 |
| Applications: | Cancer-Kinase/protease |
| MW: | 207.23 |
| Formula: | C10H13N3O2 |
| SMILES: | O=C(C1=CC=CN=C1)CCCN(C)N=O |
| Purity: | 99.90 |
| Description: | NNK is a nicotine-nitrosated derivative. NNK simultaneously stimulates Bcl2 phosphorylation exclusively at Ser70 and c-Myc at Thr58 and Ser62 through activation of both ERK1/2 and PKCα[1]. NNK induces survival and proliferation of human lung cancer cells. NNK can be used for lung cancer mice model structure[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
