Quercetin pentaacetate [CAS 1064-06-8]
Partner: MedChemexpress LLC
| CAS No: | 1064-06-8 |
| Applications: | COVID-19-anti-virus |
| MW: | 512.42 |
| Formula: | C25H20O12 |
| SMILES: | O=C1C(OC(C)=O)=C(C2=CC=C(OC(C)=O)C(OC(C)=O)=C2)OC3=CC(OC(C)=O)=CC(OC(C)=O)=C13 |
| Description: | Quercetin pentaacetate could interact with F-protein with lower binding energy and better stability to block viral adhesion. Quercetin pentaacetate interacts with RSV and inhibit the viral adhesion on cell surface[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
