RU-302 [CAS 1182129-77-6]
Partner: MedChemexpress LLC
| CAS No: | 1182129-77-6 |
| Applications: | Cancer-Kinase/protease |
| MW: | 475.53 |
| Formula: | C24H24F3N3O2S |
| SMILES: | O=C(C1=CC=CC=C1SCC2=C(C)ON=C2C)N3CCN(C4=CC=CC(C(F)(F)F)=C4)CC3 |
| Purity: | 98.02 |
| Description: | RU-302 is a pan TAM inhibitor that blocks the interface between the TAM Ig1 ectodomain and the Gas6 Lg domain. RU-302 effectively blocks Gas6-inducible Axl receptor activation with a low micromolar IC50in cell assays, and suppresses lung cancer tumor growth[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
