MLS-0437605 [CAS 862975-18-6]
Partner: MedChemexpress LLC
| CAS No: | 862975-18-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 342.35 |
| Formula: | C16H11FN4O2S |
| SMILES: | COC1=CC=C(C2=NN=C(NC3=NC4=C(F)C=CC=C4S3)O2)C=C1 |
| Purity: | 99.92 |
| Description: | MLS-0437605 is a selective dual-specificity phosphatase 3 (DUSP3) inhibitor with an IC50 of 3.7 ?M. MLS-0437605 is more selective for DUSP3 than DUSP22 and other protein tyrosine phosphatases (PTPs)[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
