Adhesamine [CAS 462605-73-8]
Partner: MedChemexpress LLC
| CAS No: | 462605-73-8 |
| MW: | 670.51 |
| Formula: | C24H32Cl4N8O2S2 |
| SMILES: | O=CC1=C(N=C(SC)N=C1N2CC[N+]3(CC[N+]4(CC3)CCN(CC4)C5=NC(SC)=NC(Cl)=C5C=O)CC2)Cl.[Cl-].[Cl-] |
| Purity: | 98.04 |
| Description: | Adhesamine, dumbbell-shaped molecule, activates MAPK/FAK pathway. Adhesamine promotes adhesion and growth of mammalian cells. Adhesamine accelerates the differentiation and improves the survival of mice hippocampal neurons in primary culture[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
