(-)-Rasfonin [CAS 303156-68-5]
Partner: MedChemexpress LLC
| CAS No: | 303156-68-5 |
| Applications: | Cancer-Kinase/protease |
| MW: | 434.57 |
| Formula: | C25H38O6 |
| SMILES: | O=C(O[C@H](C=C1)[C@@H]([C@@H](C)C[C@@H](C)C/C(C)=C/C)OC1=O)/C=C/C(C)=C/[C@@H](CO)CCO |
| Description: | (-)-Rasfonin is a fungal secondary metabolite and inhibits small G proteins Ras. (-)-Rasfonin induces apoptosis, necrosis and autophagy in ACHN cells (a renal carcinoma cell line)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
