MST-312 [CAS 368449-04-1]
Partner: MedChemexpress LLC
| CAS No: | 368449-04-1 |
| Applications: | Cancer-programmed cell death |
| MW: | 380.35 |
| Formula: | C20H16N2O6 |
| SMILES: | O=C(NC1=CC=CC(NC(C2=CC=CC(O)=C2O)=O)=C1)C3=CC=CC(O)=C3O |
| Purity: | 98.62 |
| Description: | MST-312 is a telomerase inhibitor. MST-312 is a chemically modified derivative of green tea epigallocatechin gallate (EGCG). MST-312 can be used for the research of cancer, such as multiple myeloma (MM)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
