Simvastatin acid (ammonium) [CAS 139893-43-9]
Partner: MedChemexpress LLC
| CAS No: | 139893-43-9 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 453.61 |
| Formula: | C25H43NO6 |
| SMILES: | O=C(C[C@@H](C[C@@H](CC[C@H]1[C@H](C=CC2=C[C@@H](C[C@@H]([C@]12[H])OC(C(C)(CC)C)=O)C)C)O)O)[O-].[NH4+] |
| Purity: | 99.32 |
| Description: | Simvastatin acid (Tenivastatin) ammonium is a potent HMG-CoA reductase (HMGCR) inhibitor. Simvastatin acid ammonium reduces Indoxyl sulfate-mediated reactive oxygen species (ROS) production in human cardiomyocytes. Simvastatin acid ammonium can also modulates OATP3A1 expression in cardiomyocytes and HEK293 cells transfected with the OATP3A1 gene[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
