PF-06751979 [CAS 1818339-66-0] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1818339-66-0 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 455.50 |
| Formula: | C18H19F2N5O3S2 |
| SMILES: | FC(F)OC1=CN=C(C(NC2=CSC([C@]34CO[C@@H](C)C[C@@]3([H])CSC(N)=N4)=N2)=O)C=C1 |
| Purity: | 99.23 |
| Description: | PF-06751979 is a potent, brain penetrant, ?-site amyloid precursor protein cleaving enzyme 1 (BACE1) inhibitor with an IC50 of 7.3 nM in BACE1 binding assay. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
