Rosiptor [CAS 782487-28-9]
Partner: MedChemexpress LLC
| CAS No: | 782487-28-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 321.50 |
| Formula: | C20H35NO2 |
| SMILES: | C[C@@]([C@H]1CO)(CC[C@H](O)C1)[C@](CC[C@@]2(C)[C@@]3([H])CCC2=C)([H])[C@H]3CN |
| Purity: | 99.35 |
| Description: | Rosiptor (AQX-1125) is a selective and orally active phosphatase SHIP1 activator with anti-inflammatory effects. Rosiptor (AQX-1125) inhibits Akt phosphorylation, inflammatory mediator production and leukocyte chemotaxis in vitro[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
