P-1075 [CAS 60559-98-0]
Partner: MedChemexpress LLC
| CAS No: | 60559-98-0 |
| Applications: | COVID-19-immunoregulation |
| MW: | 231.30 |
| Formula: | C12H17N5 |
| SMILES: | CCC(N/C(NC#N)=N/C1=CC=CN=C1)(C)C |
| Purity: | 99.0 |
| Description: | P-1075 is a potent activator of sulfonylurea receptor 2-associated ATP-sensitive potassium channels (SUR2-KIR6), with an EC50 value of 45 nM for SUR2B-KIR6 channel activation[1]. P-1075 also P1075 opens mitochondrial K(ATP) channels and generates reactive oxygen species resulting in cardioprotection of rabbit hearts[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
