Alexidine (dihydrochloride) [CAS 1715-30-6] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1715-30-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 581.71 |
| Formula: | C26H58Cl2N10 |
| SMILES: | N=C(NCC(CC)CCCC)NC(NCCCCCCNC(NC(NCC(CC)CCCC)=N)=N)=N.[H]Cl.[H]Cl |
| Purity: | 99.52 |
| Description: | Alexidine dihydrochloride is an anticancer agent that targets a mitochondrial tyrosine phosphatase, PTPMT1, in mammalian cells and causes mitochondrial apoptosis. Alexidine dihydrochloride has antifungal and antibiofilm activity against a diverse range of fungal pathogens[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
