Nemifitide (diTFA) [CAS 204992-09-6]
Partner: MedChemexpress LLC
| CAS No: | 204992-09-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 922.80 |
| Formula: | C37H45F7N10O10 |
| SMILES: | FC(C=C1)=CC=C1C[C@H](N)C(N2[C@@H](C[C@@H](O)C2)C(N[C@@H](CCCNC(N)=N)C(NCC(N[C@H](C(N)=O)CC3=CNC4=C3C=CC=C4)=O)=O)=O)=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| Purity: | 98.01 |
| Description: | Nemifitide diTFA (INN 00835 diTFA) is a synthetic pentapeptide antidepressant with a potential for rapid onset of action[1]. Nemifitide diTFA is a peptide analog of melanocyte-inhibiting factor (MIF)[2]. Nemifitide diTFA can cross the blood-brain barrier[3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
