JDTic (dihydrochloride) [CAS 785835-79-2]
Partner: MedChemexpress LLC
| CAS No: | 785835-79-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 538.55 |
| Formula: | C28H41Cl2N3O3 |
| SMILES: | O=C([C@@H]1NCC2=C(C=CC(O)=C2)C1)N[C@@H](C(C)C)CN3C[C@H](C)[C@](C)(C4=CC=CC(O)=C4)CC3.[H]Cl.[H]Cl |
| Purity: | 99.44 |
| Description: | JDTic (dihydrochloride) is a potent antagonist of kappa-opioid receptors (KOR), blocking the ?-agonist U50, 488-induced antinociception. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
