Boc-Asp(OMe)-fluoromethyl ketone [CAS 187389-53-3]
Partner: MedChemexpress LLC
| CAS No: | 187389-53-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 263.26 |
| Formula: | C11H18FNO5 |
| SMILES: | O=C(OC)C[C@H](NC(OC(C)(C)C)=O)C(CF)=O |
| Purity: | 98.0 |
| Description: | Boc-Asp(OME)-Fluoromethyl Ketone is a broad range caspase inhibitor that inhibits Fas-mediated phagocytosis and oxidative rupture inhibition, but does not affect the chemotactic activity of IL-8[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
