N6-Cyclopentyladenosine [CAS 41552-82-3]
Partner: MedChemexpress LLC
| CAS No: | 41552-82-3 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 335.36 |
| Formula: | C15H21N5O4 |
| SMILES: | OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3NC4CCCC4)O1)O)O |
| Purity: | 99.59 |
| Description: | N6-Cyclopentyladenosine (CPA) is a selective Adenosine A1 receptor agonist, with Ki values of 2.3 nM, 790 nM and 43 nM for human A1, A2A and A3 receptors, respectively[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
