LTURM34 [CAS 1879887-96-3]
Partner: MedChemexpress LLC
| CAS No: | 1879887-96-3 |
| Applications: | Cancer-Kinase/protease |
| MW: | 414.48 |
| Formula: | C24H18N2O3S |
| SMILES: | O=C1C2=CC=CC(C3=CC=CC4=C3SC5=C4C=CC=C5)=C2OC(N6CCOCC6)=N1 |
| Purity: | 99.89 |
| Description: | LTURM34 is a specific DNA-PK inhibitor (IC50=34 nM). LTURM34 exhibits 170-fold selectivity for DNA-PK over PI3K. LTURM34 shows potent antiproliferative activity in a wide range of tumor cell lines[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
