Barasertib [CAS 722543-31-9] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 722543-31-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 587.54 |
| Formula: | C26H31FN7O6P |
| SMILES: | O=C(NC1=CC=CC(F)=C1)CC2=CC(NC3=C4C=CC(OCCCN(CC)CCOP(O)(O)=O)=CC4=NC=N3)=NN2 |
| Purity: | 99.73 |
| Description: | Barasertib (AZD1152), a pro-drug of Barasertib-hQPA, is a highly selective Aurora B inhibitor with an IC50 of 0.37 nM in a cell-free assay. Barasertib (AZD1152) induces growth arrest and apoptosis in cancer cells[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
