(-)-Bicuculline (methobromide) [CAS 73604-30-5]
Partner: MedChemexpress LLC
| CAS No: | 73604-30-5 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 462.29 |
| Formula: | C21H20BrNO6 |
| SMILES: | C[N+]1(C)[C@@H]([C@H]2OC(C3=C4OCOC4=CC=C32)=O)C5=C(C=C6C(OCO6)=C5)CC1.[Br-] |
| Purity: | 99.0 |
| Description: | (-)-Bicuculline methobromide (l-Bicuculline methobromide) is a potent GABAA receptor antagonist. (-)-Bicuculline methobromide blocks afterhyperpolarizations (AHPs) mediated by Ca2+-activated K+ channels in various types of neurons[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
