HTHQ [CAS 148081-72-5]
Partner: MedChemexpress LLC
| CAS No: | 148081-72-5 |
| Applications: | Cancer-Kinase/protease |
| MW: | 236.35 |
| Formula: | C15H24O2 |
| SMILES: | OC1=C(C)C=C(OCCCCCC)C(C)=C1C |
| Purity: | 99.89 |
| Description: | HTHQ (1-O-hexyl-2,3,5-trimethylhydroquinone) is a potent lipophilic phenolic antioxidant. HTHQ has considerable anti-oxidative activity by directly reacting with reactive oxygen species (ROS) and scavenging ROS to form more stable free radicals[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
